About 4,4a-dihydroquinoline;propanal
4,4a-dihydroquinoline;propanal (PubChem CID 173239574) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4,4a-dihydroquinoline;propanal.
Molecular Properties
| Compound Name | 4,4a-dihydroquinoline;propanal |
| PubChem CID | 173239574 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 4,4a-dihydroquinoline;propanal |
| SMILES | C1=CC2=NC=CCC2C=C1.CCC=O |
| InChI | InChI=1S/C9H9N.C3H6O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-4/h1-4,6-8H,5H2;3H,2H2,1H3 |
| InChIKey | CRVFLMQELBKNSZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,4a-dihydroquinoline;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4a-dihydroquinoline;propanal?
The IUPAC name of 4,4a-dihydroquinoline;propanal (CID 173239574) is 4,4a-dihydroquinoline;propanal.
What is the SMILES notation for 4,4a-dihydroquinoline;propanal?
The canonical SMILES for 4,4a-dihydroquinoline;propanal is C1=CC2=NC=CCC2C=C1.CCC=O.
What is the InChIKey of 4,4a-dihydroquinoline;propanal?
The InChIKey is CRVFLMQELBKNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C3H6O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-4/h1-4,6-8H,5H2;3H,2H2,1H3.
What are the key properties of 4,4a-dihydroquinoline;propanal?
4,4a-dihydroquinoline;propanal has a molecular weight of 189.26 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4a-dihydroquinoline;propanal is sourced from PubChem (CID 173239574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).