C28H34F6N6O8 — CID 173239884
tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[2-(1H-1,2,4-triazol-1-ium-5-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 173239884) has the molecular formula C28H34F6N6O8 and a molecular weight of 696.60 g/mol. Its IUPAC name is tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[2-(1H-1,2,4-triazol-1-ium-5-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[2-(1H-1,2,4-triazol-1-ium-5-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173239884 |
| Molecular Formula | C28H34F6N6O8 |
| Molecular Weight | 696.60 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[2-(1H-1,2,4-triazol-1-ium-5-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | CCc1c(C(=O)OC(C)(C)C)[nH]c(CNc2ccc(OC)cc2)c1C(=O)NCCC1=NC=N[NH2+]1.O=C(O)C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H32N6O4.2C2HF3O2/c1-6-17-20(22(31)25-12-11-19-27-14-28-30-19)18(29-21(17)23(32)34-24(2,3)4)13-26-15-7-9-16(33-5)10-8-15;2*3-2(4,5)1(6)7/h7-10,14,26,29H,6,11-13H2,1-5H3,(H,25,31)(H,27,28,30);2*(H,6,7) |
| InChIKey | GNYKWDCQTNXCDD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 211.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|