C25H31F3N6O7 — CID 173240077
tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 173240077) has the molecular formula C25H31F3N6O7 and a molecular weight of 584.55 g/mol. Its IUPAC name is tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173240077 |
| Molecular Formula | C25H31F3N6O7 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylcarbamoyl]-1H-pyrrole-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCc1c(C(=O)OC(C)(C)C)[nH]c(CNc2ccc(OC)cc2)c1C(=O)NCc1n[nH]c(=O)[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30N6O5.C2HF3O2/c1-6-15-18(20(30)25-12-17-27-22(32)29-28-17)16(26-19(15)21(31)34-23(2,3)4)11-24-13-7-9-14(33-5)10-8-13;3-2(4,5)1(6)7/h7-10,24,26H,6,11-12H2,1-5H3,(H,25,30)(H2,27,28,29,32);(H,6,7) |
| InChIKey | TZESEWPSZWYXSA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 191.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|