C29H36F6N6O8 — CID 173240099
tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 173240099) has the molecular formula C29H36F6N6O8 and a molecular weight of 710.63 g/mol. Its IUPAC name is tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 173240099 |
| Molecular Formula | C29H36F6N6O8 |
| Molecular Weight | 710.63 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | tert-butyl 3-ethyl-5-[(4-methoxyanilino)methyl]-4-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1H-pyrrole-2-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCc1c(C(=O)OC(C)(C)C)[nH]c(CNc2ccc(OC)cc2)c1C(=O)NC(C)c1n[nH]c(C)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H34N6O4.2C2HF3O2/c1-8-18-20(23(32)27-14(2)22-28-15(3)30-31-22)19(29-21(18)24(33)35-25(4,5)6)13-26-16-9-11-17(34-7)12-10-16;2*3-2(4,5)1(6)7/h9-12,14,26,29H,8,13H2,1-7H3,(H,27,32)(H,28,30,31);2*(H,6,7) |
| InChIKey | IWHANHRXYZNZRH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 208.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|