C27H31F6N5O8 — CID 173240150
2-O-tert-butyl 4-O-methyl 3-ethyl-5-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methyl]-1H-pyrrole-2,4-dicarboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 173240150) has the molecular formula C27H31F6N5O8 and a molecular weight of 667.56 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl 3-ethyl-5-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methyl]-1H-pyrrole-2,4-dicarboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-O-tert-butyl 4-O-methyl 3-ethyl-5-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methyl]-1H-pyrrole-2,4-dicarboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 173240150 |
| Molecular Formula | C27H31F6N5O8 |
| Molecular Weight | 667.56 g/mol |
| Exact Mass | 667.21 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl 3-ethyl-5-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methyl]-1H-pyrrole-2,4-dicarboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCc1c(C(=O)OC(C)(C)C)[nH]c(CNc2ccc(-c3n[nH]c(C)n3)cc2)c1C(=O)OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H29N5O4.2C2HF3O2/c1-7-16-18(21(29)31-6)17(26-19(16)22(30)32-23(3,4)5)12-24-15-10-8-14(9-11-15)20-25-13(2)27-28-20;2*3-2(4,5)1(6)7/h8-11,24,26H,7,12H2,1-6H3,(H,25,27,28);2*(H,6,7) |
| InChIKey | VQFPKUZLUMJWQL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 196.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |