C17H38O2Si2 — CID 173240237
2,2-dimethyloxasilinane;2-(2,3,3-trimethylbutan-2-yl)oxasilinane (PubChem CID 173240237) has the molecular formula C17H38O2Si2 and a molecular weight of 330.66 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;2-(2,3,3-trimethylbutan-2-yl)oxasilinane.
| Compound Name | 2,2-dimethyloxasilinane;2-(2,3,3-trimethylbutan-2-yl)oxasilinane |
|---|---|
| PubChem CID | 173240237 |
| Molecular Formula | C17H38O2Si2 |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 2,2-dimethyloxasilinane;2-(2,3,3-trimethylbutan-2-yl)oxasilinane |
| SMILES | CC(C)(C)C(C)(C)[SiH]1CCCCO1.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C11H24OSi.C6H14OSi/c1-10(2,3)11(4,5)13-9-7-6-8-12-13;1-8(2)6-4-3-5-7-8/h13H,6-9H2,1-5H3;3-6H2,1-2H3 |
| InChIKey | QTOLOIYGLPXMBM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|