About (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid
(5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid (PubChem CID 173241008) has the molecular formula C16H32O4Si
and a molecular weight of 316.51 g/mol. Its IUPAC name is (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid.
Molecular Properties
| Compound Name | (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid |
| PubChem CID | 173241008 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid |
| SMILES | CC=C[C@@H](O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)O |
| InChI | InChI=1S/C16H32O4Si/c1-9-10-13(17)11(2)14(12(3)15(18)19)20-21(7,8)16(4,5)6/h9-14,17H,1-8H3,(H,18,19)/t11?,12?,13-,14?/m1/s1 |
| InChIKey | YIIYIVJUXVDQCE-WCFLAILDSA-N |
| XLogP | 3.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid?
The IUPAC name of (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid (CID 173241008) is (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid.
What is the SMILES notation for (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid?
The canonical SMILES for (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid is CC=C[C@@H](O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)O.
What is the InChIKey of (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid?
The InChIKey is YIIYIVJUXVDQCE-WCFLAILDSA-N. The full InChI is InChI=1S/C16H32O4Si/c1-9-10-13(17)11(2)14(12(3)15(18)19)20-21(7,8)16(4,5)6/h9-14,17H,1-8H3,(H,18,19)/t11?,12?,13-,14?/m1/s1.
What are the key properties of (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid?
(5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid has a molecular weight of 316.51 g/mol, XLogP of 3.67, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid is sourced from PubChem (CID 173241008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).