C24H40O2Si — CID 173241078
(4aR,5R)-4a-methyl-5-[(2R)-8-methyl-8-trimethylsilyloxynona-4,6-dien-2-yl]-2,3,4,5,6,7-hexahydronaphthalen-1-one (PubChem CID 173241078) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (4aR,5R)-4a-methyl-5-[(2R)-8-methyl-8-trimethylsilyloxynona-4,6-dien-2-yl]-2,3,4,5,6,7-hexahydronaphthalen-1-one.
| Compound Name | (4aR,5R)-4a-methyl-5-[(2R)-8-methyl-8-trimethylsilyloxynona-4,6-dien-2-yl]-2,3,4,5,6,7-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 173241078 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (4aR,5R)-4a-methyl-5-[(2R)-8-methyl-8-trimethylsilyloxynona-4,6-dien-2-yl]-2,3,4,5,6,7-hexahydronaphthalen-1-one |
| SMILES | C[C@H](CC=CC=CC(C)(C)O[Si](C)(C)C)[C@H]1CCC=C2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C24H40O2Si/c1-19(13-9-8-10-17-23(2,3)26-27(5,6)7)20-14-11-15-21-22(25)16-12-18-24(20,21)4/h8-10,15,17,19-20H,11-14,16,18H2,1-7H3/t19-,20-,24-/m1/s1 |
| InChIKey | BKCTWWDBZGXXNH-YOSAUDMPSA-N |
| XLogP | 6.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|