C14H12F4N2O2 — CID 173241255
3-methyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-2H-pyridin-6-amine (PubChem CID 173241255) has the molecular formula C14H12F4N2O2 and a molecular weight of 316.25 g/mol. Its IUPAC name is 3-methyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-2H-pyridin-6-amine.
| Compound Name | 3-methyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 173241255 |
| Molecular Formula | C14H12F4N2O2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-methyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-2H-pyridin-6-amine |
| SMILES | CC1=CC=C(N)N(c2ccc3c(c2)OC(F)(F)C(F)(F)O3)C1 |
| InChI | InChI=1S/C14H12F4N2O2/c1-8-2-5-12(19)20(7-8)9-3-4-10-11(6-9)22-14(17,18)13(15,16)21-10/h2-6H,7,19H2,1H3 |
| InChIKey | ALVRLXUUSSWJIW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|