About (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride
(Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride (PubChem CID 173241581) has the molecular formula C24H52ClNO3Si
and a molecular weight of 466.22 g/mol. Its IUPAC name is (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride |
| PubChem CID | 173241581 |
| Molecular Formula | C24H52ClNO3Si |
| Molecular Weight | 466.22 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCC)[Si](OC)(OC)OC.Cl |
| InChI | InChI=1S/C24H51NO3Si.ClH/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-25(23-7-2)29(26-3,27-4)28-5;/h14-15H,6-13,16-24H2,1-5H3;1H/b15-14-; |
| InChIKey | FGZZWEAPXJUIJV-BGWNKZQTSA-N |
| XLogP | 7.53 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.22 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride?
The IUPAC name of (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride (CID 173241581) is (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride.
What is the SMILES notation for (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride?
The canonical SMILES for (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride is CCCCCCCC/C=C\CCCCCCCCN(CCC)[Si](OC)(OC)OC.Cl.
What is the InChIKey of (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride?
The InChIKey is FGZZWEAPXJUIJV-BGWNKZQTSA-N. The full InChI is InChI=1S/C24H51NO3Si.ClH/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-25(23-7-2)29(26-3,27-4)28-5;/h14-15H,6-13,16-24H2,1-5H3;1H/b15-14-;.
What are the key properties of (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride?
(Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride has a molecular weight of 466.22 g/mol, XLogP of 7.53, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-propyl-N-trimethoxysilyloctadec-9-en-1-amine;hydrochloride is sourced from PubChem (CID 173241581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).