C20H23N9O6S — CID 173242482
azane;(2S)-2-[[1-[(2,4-diaminopteridin-6-yl)methyl]indole-5-carbonyl]amino]-4-sulfobutanoic acid (PubChem CID 173242482) has the molecular formula C20H23N9O6S and a molecular weight of 517.53 g/mol. Its IUPAC name is azane;(2S)-2-[[1-[(2,4-diaminopteridin-6-yl)methyl]indole-5-carbonyl]amino]-4-sulfobutanoic acid.
| Compound Name | azane;(2S)-2-[[1-[(2,4-diaminopteridin-6-yl)methyl]indole-5-carbonyl]amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 173242482 |
| Molecular Formula | C20H23N9O6S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | azane;(2S)-2-[[1-[(2,4-diaminopteridin-6-yl)methyl]indole-5-carbonyl]amino]-4-sulfobutanoic acid |
| SMILES | N.Nc1nc(N)c2nc(Cn3ccc4cc(C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O)ccc43)cnc2n1 |
| InChI | InChI=1S/C20H20N8O6S.H3N/c21-16-15-17(27-20(22)26-16)23-8-12(24-15)9-28-5-3-10-7-11(1-2-14(10)28)18(29)25-13(19(30)31)4-6-35(32,33)34;/h1-3,5,7-8,13H,4,6,9H2,(H,25,29)(H,30,31)(H,32,33,34)(H4,21,22,23,26,27);1H3/t13-;/m0./s1 |
| InChIKey | XXVJUSSRBBEGJP-ZOWNYOTGSA-N |
| XLogP | 0.21 |
| TPSA | 264.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|