C16H10 — CID 173242499
tetracyclo[10.3.1.02,10.03,8]hexadeca-1(15),2,4,6,8,10,12(16),13-octaene (PubChem CID 173242499) has the molecular formula C16H10 and a molecular weight of 202.26 g/mol. Its IUPAC name is tetracyclo[10.3.1.02,10.03,8]hexadeca-1(15),2,4,6,8,10,12(16),13-octaene.
| Compound Name | tetracyclo[10.3.1.02,10.03,8]hexadeca-1(15),2,4,6,8,10,12(16),13-octaene |
|---|---|
| PubChem CID | 173242499 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | tetracyclo[10.3.1.02,10.03,8]hexadeca-1(15),2,4,6,8,10,12(16),13-octaene |
| SMILES | C1=c2ccccc2=c2c1cc1cccc2c1 |
| InChI | InChI=1S/C16H10/c1-2-7-15-12(5-1)10-14-9-11-4-3-6-13(8-11)16(14)15/h1-10H |
| InChIKey | VPXMAOGHHAYKPY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |