C39H55N3 — CID 173243005
1-[6-[C-methyl-N-(2,4,6-tripropylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2,4,6-tripropylphenyl)ethanimine (PubChem CID 173243005) has the molecular formula C39H55N3 and a molecular weight of 565.89 g/mol. Its IUPAC name is 1-[6-[C-methyl-N-(2,4,6-tripropylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2,4,6-tripropylphenyl)ethanimine.
| Compound Name | 1-[6-[C-methyl-N-(2,4,6-tripropylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2,4,6-tripropylphenyl)ethanimine |
|---|---|
| PubChem CID | 173243005 |
| Molecular Formula | C39H55N3 |
| Molecular Weight | 565.89 g/mol |
| Exact Mass | 565.44 |
| IUPAC Name | 1-[6-[C-methyl-N-(2,4,6-tripropylphenyl)carbonimidoyl]-2-pyridinyl]-N-(2,4,6-tripropylphenyl)ethanimine |
| SMILES | CCCc1cc(CCC)c(/N=C(\C)c2cccc(/C(C)=N/c3c(CCC)cc(CCC)cc3CCC)n2)c(CCC)c1 |
| InChI | InChI=1S/C39H55N3/c1-9-16-30-24-32(18-11-3)38(33(25-30)19-12-4)40-28(7)36-22-15-23-37(42-36)29(8)41-39-34(20-13-5)26-31(17-10-2)27-35(39)21-14-6/h15,22-27H,9-14,16-21H2,1-8H3/b40-28+,41-29+ |
| InChIKey | ZXQMWZKIZYKNLJ-ICKILNQYSA-N |
| XLogP | 11.08 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.89 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|