C17H28N4O5Si — CID 173243580
1,1,2-trimethoxy-2-silylethanamine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 173243580) has the molecular formula C17H28N4O5Si and a molecular weight of 396.52 g/mol. Its IUPAC name is 1,1,2-trimethoxy-2-silylethanamine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 1,1,2-trimethoxy-2-silylethanamine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 173243580 |
| Molecular Formula | C17H28N4O5Si |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1,1,2-trimethoxy-2-silylethanamine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC([SiH3])C(N)(OC)OC.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C5H15NO3Si/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-7-4(10)5(6,8-2)9-3/h7H,1-6H2;4H,6H2,1-3,10H3 |
| InChIKey | KMWZZKLUXZKIRT-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|