C29H36Hf — CID 173243960
4,7-dimethyl-1H-inden-1-ide;4,7-di(propan-2-yl)-1,2-dihydroinden-2-ide;propan-2-ylidenehafnium(2+) (PubChem CID 173243960) has the molecular formula C29H36Hf and a molecular weight of 563.10 g/mol. Its IUPAC name is 4,7-dimethyl-1H-inden-1-ide;4,7-di(propan-2-yl)-1,2-dihydroinden-2-ide;propan-2-ylidenehafnium(2+).
| Compound Name | 4,7-dimethyl-1H-inden-1-ide;4,7-di(propan-2-yl)-1,2-dihydroinden-2-ide;propan-2-ylidenehafnium(2+) |
|---|---|
| PubChem CID | 173243960 |
| Molecular Formula | C29H36Hf |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 4,7-dimethyl-1H-inden-1-ide;4,7-di(propan-2-yl)-1,2-dihydroinden-2-ide;propan-2-ylidenehafnium(2+) |
| SMILES | CC(C)=[Hf+2].CC(C)c1ccc(C(C)C)c2c1C=[C-]C2.Cc1ccc(C)c2[cH-]ccc12 |
| InChI | InChI=1S/C15H19.C11H11.C3H6.Hf/c1-10(2)12-8-9-13(11(3)4)15-7-5-6-14(12)15;1-8-6-7-9(2)11-5-3-4-10(8)11;1-3-2;/h6,8-11H,7H2,1-4H3;3-7H,1-2H3;1-2H3;/q2*-1;;+2 |
| InChIKey | FHCABZAEOCFAAE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|