About chrysene;2-methylprop-1-ene
chrysene;2-methylprop-1-ene (PubChem CID 173244266) has the molecular formula C22H20
and a molecular weight of 284.40 g/mol. Its IUPAC name is chrysene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | chrysene;2-methylprop-1-ene |
| PubChem CID | 173244266 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | chrysene;2-methylprop-1-ene |
| SMILES | C=C(C)C.c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12.C4H8/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-4(2)3/h1-12H;1H2,2-3H3 |
| InChIKey | YLFIRJXTQBNNFZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze chrysene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chrysene;2-methylprop-1-ene?
The IUPAC name of chrysene;2-methylprop-1-ene (CID 173244266) is chrysene;2-methylprop-1-ene.
What is the SMILES notation for chrysene;2-methylprop-1-ene?
The canonical SMILES for chrysene;2-methylprop-1-ene is C=C(C)C.c1ccc2c(c1)ccc1c3ccccc3ccc21.
What is the InChIKey of chrysene;2-methylprop-1-ene?
The InChIKey is YLFIRJXTQBNNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.C4H8/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-4(2)3/h1-12H;1H2,2-3H3.
What are the key properties of chrysene;2-methylprop-1-ene?
chrysene;2-methylprop-1-ene has a molecular weight of 284.40 g/mol, XLogP of 6.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene;2-methylprop-1-ene is sourced from PubChem (CID 173244266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).