C20H23F3O2 — CID 173244279
(8R,9S,13S,14S)-13-ethyl-2-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 173244279) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-ethyl-2-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-ethyl-2-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 173244279 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (8R,9S,13S,14S)-13-ethyl-2-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC[C@]12CC[C@@H]3c4cc(OC(F)(F)F)ccc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H23F3O2/c1-2-19-10-9-14-15(17(19)7-8-18(19)24)6-4-12-3-5-13(11-16(12)14)25-20(21,22)23/h3,5,11,14-15,17H,2,4,6-10H2,1H3/t14-,15+,17-,19-/m0/s1 |
| InChIKey | VIQFAEANWVRGMX-HIRMHNASSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |