About 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride
2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride (PubChem CID 17324428) has the molecular formula C22H21ClN4O2
and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 17324428 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride |
| SMILES | COc1ccc(Nc2nc(Nc3ccc(OC)cc3)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C22H20N4O2.ClH/c1-27-17-11-7-15(8-12-17)23-21-19-5-3-4-6-20(19)25-22(26-21)24-16-9-13-18(28-2)14-10-16;/h3-14H,1-2H3,(H2,23,24,25,26);1H |
| InChIKey | TXKQPZLJQPAIJQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride (CID 17324428) is 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride is COc1ccc(Nc2nc(Nc3ccc(OC)cc3)c3ccccc3n2)cc1.Cl.
What is the InChIKey of 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride?
The InChIKey is TXKQPZLJQPAIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O2.ClH/c1-27-17-11-7-15(8-12-17)23-21-19-5-3-4-6-20(19)25-22(26-21)24-16-9-13-18(28-2)14-10-16;/h3-14H,1-2H3,(H2,23,24,25,26);1H.
What are the key properties of 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride?
2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride has a molecular weight of 408.89 g/mol, XLogP of 5.56, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-bis(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 17324428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).