C24H28N4O4 — CID 17324446
ethyl 2-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 17324446) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 2-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 17324446 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | ethyl 2-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC(N2CCN(c3ccccc3OC)CC2)=NC1c1ccccc1 |
| InChI | InChI=1S/C24H28N4O4/c1-3-32-23(30)20-21(17-9-5-4-6-10-17)25-24(26-22(20)29)28-15-13-27(14-16-28)18-11-7-8-12-19(18)31-2/h4-12,20-21H,3,13-16H2,1-2H3,(H,25,26,29) |
| InChIKey | JDOHYXNJOJZTRX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|