About lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride
lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride (PubChem CID 173245177) has the molecular formula C16H12F6LiOP
and a molecular weight of 372.17 g/mol. Its IUPAC name is lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride.
Molecular Properties
| Compound Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride |
| PubChem CID | 173245177 |
| Molecular Formula | C16H12F6LiOP |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride |
| SMILES | Cc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)cc1.[H-].[Li+] |
| InChI | InChI=1S/C16H11F6OP.Li.H/c1-9-5-7-10(8-6-9)24-14(23)13-11(15(17,18)19)3-2-4-12(13)16(20,21)22;;/h2-8,24H,1H3;;/q;+1;-1 |
| InChIKey | HBCHUIGMHCWKJT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride?
The IUPAC name of lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride (CID 173245177) is lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride.
What is the SMILES notation for lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride?
The canonical SMILES for lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride is Cc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)cc1.[H-].[Li+].
What is the InChIKey of lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride?
The InChIKey is HBCHUIGMHCWKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F6OP.Li.H/c1-9-5-7-10(8-6-9)24-14(23)13-11(15(17,18)19)3-2-4-12(13)16(20,21)22;;/h2-8,24H,1H3;;/q;+1;-1.
What are the key properties of lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride?
lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride has a molecular weight of 372.17 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-methylphenyl)phosphanylmethanone;hydride is sourced from PubChem (CID 173245177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).