C22H28O6P+ — CID 173245862
1-methoxyethyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propaneperoxoate;oxophosphanium (PubChem CID 173245862) has the molecular formula C22H28O6P+ and a molecular weight of 419.43 g/mol. Its IUPAC name is 1-methoxyethyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propaneperoxoate;oxophosphanium.
| Compound Name | 1-methoxyethyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propaneperoxoate;oxophosphanium |
|---|---|
| PubChem CID | 173245862 |
| Molecular Formula | C22H28O6P+ |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-methoxyethyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propaneperoxoate;oxophosphanium |
| SMILES | COC(C)OOC(=O)C(C(=O)c1c(C)cc(C)c(C)c1C)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C22H26O5.H2OP/c1-13-12-14(2)19(16(4)15(13)3)21(23)20(18-10-8-7-9-11-18)22(24)27-26-17(5)25-6;1-2/h7-12,17,20H,1-6H3;2H2/q;+1 |
| InChIKey | FBVTZNPQQJMZTC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|