About potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride
potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride (PubChem CID 173246212) has the molecular formula C10H18KN5O3
and a molecular weight of 295.38 g/mol. Its IUPAC name is potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride.
Molecular Properties
| Compound Name | potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride |
| PubChem CID | 173246212 |
| Molecular Formula | C10H18KN5O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride |
| SMILES | Nc1nc2c(c(=O)[nH]1)NCN2CCC(CO)CO.[H-].[K+] |
| InChI | InChI=1S/C10H17N5O3.K.H/c11-10-13-8-7(9(18)14-10)12-5-15(8)2-1-6(3-16)4-17;;/h6,12,16-17H,1-5H2,(H3,11,13,14,18);;/q;+1;-1 |
| InChIKey | VRFMCCSOESHETI-UHFFFAOYSA-N |
| XLogP | -4.35 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride?
The IUPAC name of potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride (CID 173246212) is potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride.
What is the SMILES notation for potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride?
The canonical SMILES for potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride is Nc1nc2c(c(=O)[nH]1)NCN2CCC(CO)CO.[H-].[K+].
What is the InChIKey of potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride?
The InChIKey is VRFMCCSOESHETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3.K.H/c11-10-13-8-7(9(18)14-10)12-5-15(8)2-1-6(3-16)4-17;;/h6,12,16-17H,1-5H2,(H3,11,13,14,18);;/q;+1;-1.
What are the key properties of potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride?
potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride has a molecular weight of 295.38 g/mol, XLogP of -4.35, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7,8-dihydro-1H-purin-6-one;hydride is sourced from PubChem (CID 173246212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).