About 4-amino-4-oxobut-2-enoic acid;azane
4-amino-4-oxobut-2-enoic acid;azane (PubChem CID 173246306) has the molecular formula C4H8N2O3
and a molecular weight of 132.12 g/mol. Its IUPAC name is 4-amino-4-oxobut-2-enoic acid;azane.
Molecular Properties
| Compound Name | 4-amino-4-oxobut-2-enoic acid;azane |
| PubChem CID | 173246306 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | 4-amino-4-oxobut-2-enoic acid;azane |
| SMILES | N.NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C4H5NO3.H3N/c5-3(6)1-2-4(7)8;/h1-2H,(H2,5,6)(H,7,8);1H3 |
| InChIKey | ZFJLXTJORIDUGY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4-oxobut-2-enoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-oxobut-2-enoic acid;azane?
The IUPAC name of 4-amino-4-oxobut-2-enoic acid;azane (CID 173246306) is 4-amino-4-oxobut-2-enoic acid;azane.
What is the SMILES notation for 4-amino-4-oxobut-2-enoic acid;azane?
The canonical SMILES for 4-amino-4-oxobut-2-enoic acid;azane is N.NC(=O)C=CC(=O)O.
What is the InChIKey of 4-amino-4-oxobut-2-enoic acid;azane?
The InChIKey is ZFJLXTJORIDUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.H3N/c5-3(6)1-2-4(7)8;/h1-2H,(H2,5,6)(H,7,8);1H3.
What are the key properties of 4-amino-4-oxobut-2-enoic acid;azane?
4-amino-4-oxobut-2-enoic acid;azane has a molecular weight of 132.12 g/mol, XLogP of -0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-oxobut-2-enoic acid;azane is sourced from PubChem (CID 173246306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).