C26H34BrF2O5PS2 — CID 173246329
[[2-bromo-3,5-ditert-butyl-4-[3-(3-methylsulfonylphenyl)prop-2-enylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 173246329) has the molecular formula C26H34BrF2O5PS2 and a molecular weight of 639.56 g/mol. Its IUPAC name is [[2-bromo-3,5-ditert-butyl-4-[3-(3-methylsulfonylphenyl)prop-2-enylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-3,5-ditert-butyl-4-[3-(3-methylsulfonylphenyl)prop-2-enylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 173246329 |
| Molecular Formula | C26H34BrF2O5PS2 |
| Molecular Weight | 639.56 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | [[2-bromo-3,5-ditert-butyl-4-[3-(3-methylsulfonylphenyl)prop-2-enylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CC(C)(C)c1cc(C(F)(F)P(=O)(O)O)c(Br)c(C(C)(C)C)c1CSCC=Cc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H34BrF2O5PS2/c1-24(2,3)20-15-21(26(28,29)35(30,31)32)23(27)22(25(4,5)6)19(20)16-36-13-9-11-17-10-8-12-18(14-17)37(7,33)34/h8-12,14-15H,13,16H2,1-7H3,(H2,30,31,32) |
| InChIKey | OHOYFEJNMWBWHJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|