About (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium
(3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium (PubChem CID 173246772) has the molecular formula C14H25OSiTi-
and a molecular weight of 285.31 g/mol. Its IUPAC name is (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium.
Molecular Properties
| Compound Name | (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium |
| PubChem CID | 173246772 |
| Molecular Formula | C14H25OSiTi- |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium |
| SMILES | CCCCOC(CC[SiH](C)C)C1=[C-]CC=C1.[Ti] |
| InChI | InChI=1S/C14H25OSi.Ti/c1-4-5-11-15-14(10-12-16(2)3)13-8-6-7-9-13;/h6,8,14,16H,4-5,7,10-12H2,1-3H3;/q-1; |
| InChIKey | KCDPGVAGASEHFA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium?
The IUPAC name of (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium (CID 173246772) is (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium.
What is the SMILES notation for (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium?
The canonical SMILES for (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium is CCCCOC(CC[SiH](C)C)C1=[C-]CC=C1.[Ti].
What is the InChIKey of (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium?
The InChIKey is KCDPGVAGASEHFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25OSi.Ti/c1-4-5-11-15-14(10-12-16(2)3)13-8-6-7-9-13;/h6,8,14,16H,4-5,7,10-12H2,1-3H3;/q-1;.
What are the key properties of (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium?
(3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium has a molecular weight of 285.31 g/mol, XLogP of 3.74, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butoxy-3-cyclopenta-1,4-dien-1-ylpropyl)-dimethylsilane;titanium is sourced from PubChem (CID 173246772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).