C14H14Cl2Rh2 — CID 173246942
bicyclo[2.2.1]hepta-2,5-diene;2,3-dichlorobicyclo[2.2.1]hepta-2,5-diene;bis(rhodium) (PubChem CID 173246942) has the molecular formula C14H14Cl2Rh2 and a molecular weight of 458.98 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;2,3-dichlorobicyclo[2.2.1]hepta-2,5-diene;bis(rhodium).
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;2,3-dichlorobicyclo[2.2.1]hepta-2,5-diene;bis(rhodium) |
|---|---|
| PubChem CID | 173246942 |
| Molecular Formula | C14H14Cl2Rh2 |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 457.86 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;2,3-dichlorobicyclo[2.2.1]hepta-2,5-diene;bis(rhodium) |
| SMILES | C1=CC2C=CC1C2.ClC1=C(Cl)C2C=CC1C2.[Rh].[Rh] |
| InChI | InChI=1S/C7H6Cl2.C7H8.2Rh/c8-6-4-1-2-5(3-4)7(6)9;1-2-7-4-3-6(1)5-7;;/h1-2,4-5H,3H2;1-4,6-7H,5H2;; |
| InChIKey | QRTMBDCPVHDFHA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|