About CID 173246946
CID 173246946 (PubChem CID 173246946) has the molecular formula C13H11BrF2NNa2O3PS
and a molecular weight of 456.16 g/mol.
Molecular Properties
| Compound Name | CID 173246946 |
| PubChem CID | 173246946 |
| Molecular Formula | C13H11BrF2NNa2O3PS |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 454.91 |
| IUPAC Name | — |
| SMILES | O=P(O)(Oc1ccc(CSc2cccnc2)cc1Br)C(F)F.[Na].[Na] |
| InChI | InChI=1S/C13H11BrF2NO3PS.2Na/c14-11-6-9(8-22-10-2-1-5-17-7-10)3-4-12(11)20-21(18,19)13(15)16;;/h1-7,13H,8H2,(H,18,19);; |
| InChIKey | RMJJAHJDARNGBK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 173246946 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173246946?
The IUPAC name of CID 173246946 (CID 173246946) is not available.
What is the SMILES notation for CID 173246946?
The canonical SMILES for CID 173246946 is O=P(O)(Oc1ccc(CSc2cccnc2)cc1Br)C(F)F.[Na].[Na].
What is the InChIKey of CID 173246946?
The InChIKey is RMJJAHJDARNGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrF2NO3PS.2Na/c14-11-6-9(8-22-10-2-1-5-17-7-10)3-4-12(11)20-21(18,19)13(15)16;;/h1-7,13H,8H2,(H,18,19);;.
What are the key properties of CID 173246946?
CID 173246946 has a molecular weight of 456.16 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173246946 is sourced from PubChem (CID 173246946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).