C9H16Cl2SiZr — CID 173246971
(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane;zirconium(2+);dichloride (PubChem CID 173246971) has the molecular formula C9H16Cl2SiZr and a molecular weight of 314.44 g/mol. Its IUPAC name is (2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane;zirconium(2+);dichloride.
| Compound Name | (2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane;zirconium(2+);dichloride |
|---|---|
| PubChem CID | 173246971 |
| Molecular Formula | C9H16Cl2SiZr |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | (2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane;zirconium(2+);dichloride |
| SMILES | CC1=C(C)C(C)C([SiH3])=C1C.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C9H16Si.2ClH.Zr/c1-5-6(2)8(4)9(10)7(5)3;;;/h7H,1-4,10H3;2*1H;/q;;;+2/p-2 |
| InChIKey | COQDJTZRRNOGED-UHFFFAOYSA-L |
| XLogP | -4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|