About diethoxysilane;9-(methoxymethyl)anthracene
diethoxysilane;9-(methoxymethyl)anthracene (PubChem CID 173247688) has the molecular formula C20H26O3Si
and a molecular weight of 342.51 g/mol. Its IUPAC name is diethoxysilane;9-(methoxymethyl)anthracene.
Molecular Properties
| Compound Name | diethoxysilane;9-(methoxymethyl)anthracene |
| PubChem CID | 173247688 |
| Molecular Formula | C20H26O3Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | diethoxysilane;9-(methoxymethyl)anthracene |
| SMILES | CCO[SiH2]OCC.COCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C16H14O.C4H12O2Si/c1-17-11-16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16;1-3-5-7-6-4-2/h2-10H,11H2,1H3;3-4,7H2,1-2H3 |
| InChIKey | RCSADWFFWZAZEM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze diethoxysilane;9-(methoxymethyl)anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxysilane;9-(methoxymethyl)anthracene?
The IUPAC name of diethoxysilane;9-(methoxymethyl)anthracene (CID 173247688) is diethoxysilane;9-(methoxymethyl)anthracene.
What is the SMILES notation for diethoxysilane;9-(methoxymethyl)anthracene?
The canonical SMILES for diethoxysilane;9-(methoxymethyl)anthracene is CCO[SiH2]OCC.COCc1c2ccccc2cc2ccccc12.
What is the InChIKey of diethoxysilane;9-(methoxymethyl)anthracene?
The InChIKey is RCSADWFFWZAZEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O.C4H12O2Si/c1-17-11-16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16;1-3-5-7-6-4-2/h2-10H,11H2,1H3;3-4,7H2,1-2H3.
What are the key properties of diethoxysilane;9-(methoxymethyl)anthracene?
diethoxysilane;9-(methoxymethyl)anthracene has a molecular weight of 342.51 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxysilane;9-(methoxymethyl)anthracene is sourced from PubChem (CID 173247688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).