About 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine
3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine (PubChem CID 173249574) has the molecular formula C8H20N4O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine.
Molecular Properties
| Compound Name | 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine |
| PubChem CID | 173249574 |
| Molecular Formula | C8H20N4O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine |
| SMILES | CCNC(=O)C=C(N)CN.CNC |
| InChI | InChI=1S/C6H13N3O.C2H7N/c1-2-9-6(10)3-5(8)4-7;1-3-2/h3H,2,4,7-8H2,1H3,(H,9,10);3H,1-2H3 |
| InChIKey | HIUDACAPGDQANE-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine?
The IUPAC name of 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine (CID 173249574) is 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine.
What is the SMILES notation for 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine?
The canonical SMILES for 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine is CCNC(=O)C=C(N)CN.CNC.
What is the InChIKey of 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine?
The InChIKey is HIUDACAPGDQANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O.C2H7N/c1-2-9-6(10)3-5(8)4-7;1-3-2/h3H,2,4,7-8H2,1H3,(H,9,10);3H,1-2H3.
What are the key properties of 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine?
3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine has a molecular weight of 188.27 g/mol, XLogP of -1.24, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-N-ethylbut-2-enamide;N-methylmethanamine is sourced from PubChem (CID 173249574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).