C25H36F3N3O3Si — CID 173249811
2-(3-amino-2-oxo-6-phenyl-1-pyridinyl)-N-[2,2,4,5,5-pentamethyl-3-silyloxy-4-(trifluoromethyl)hexan-3-yl]acetamide (PubChem CID 173249811) has the molecular formula C25H36F3N3O3Si and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-(3-amino-2-oxo-6-phenyl-1-pyridinyl)-N-[2,2,4,5,5-pentamethyl-3-silyloxy-4-(trifluoromethyl)hexan-3-yl]acetamide.
| Compound Name | 2-(3-amino-2-oxo-6-phenyl-1-pyridinyl)-N-[2,2,4,5,5-pentamethyl-3-silyloxy-4-(trifluoromethyl)hexan-3-yl]acetamide |
|---|---|
| PubChem CID | 173249811 |
| Molecular Formula | C25H36F3N3O3Si |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 2-(3-amino-2-oxo-6-phenyl-1-pyridinyl)-N-[2,2,4,5,5-pentamethyl-3-silyloxy-4-(trifluoromethyl)hexan-3-yl]acetamide |
| SMILES | CC(C)(C)C(NC(=O)Cn1c(-c2ccccc2)ccc(N)c1=O)(O[SiH3])C(C)(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C25H36F3N3O3Si/c1-21(2,3)23(7,25(26,27)28)24(34-35,22(4,5)6)30-19(32)15-31-18(14-13-17(29)20(31)33)16-11-9-8-10-12-16/h8-14H,15,29H2,1-7,35H3,(H,30,32) |
| InChIKey | XOOPQELSYDUVOP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|