C14H15LiN2 — CID 173250202
lithium;(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinoline;hydride (PubChem CID 173250202) has the molecular formula C14H15LiN2 and a molecular weight of 218.23 g/mol. Its IUPAC name is lithium;(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinoline;hydride.
| Compound Name | lithium;(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinoline;hydride |
|---|---|
| PubChem CID | 173250202 |
| Molecular Formula | C14H15LiN2 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | lithium;(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinoline;hydride |
| SMILES | C1=Nc2cccc3c2C=1C[C@H]1NCCC[C@H]31.[H-].[Li+] |
| InChI | InChI=1S/C14H14N2.Li.H/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11;;/h1,3,5,10,13,15H,2,4,6-7H2;;/q;+1;-1/t10-,13-;;/m1../s1 |
| InChIKey | YEGLUYLYXLQPMK-OWVUFADGSA-N |
| XLogP | -0.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |