C18H27N3O2 — CID 173250542
(1S,3aS,5S,7aR)-1-(2-aminoethoxyiminomethyl)-7a-methyl-5-pyridin-3-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 173250542) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (1S,3aS,5S,7aR)-1-(2-aminoethoxyiminomethyl)-7a-methyl-5-pyridin-3-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1S,3aS,5S,7aR)-1-(2-aminoethoxyiminomethyl)-7a-methyl-5-pyridin-3-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 173250542 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (1S,3aS,5S,7aR)-1-(2-aminoethoxyiminomethyl)-7a-methyl-5-pyridin-3-yl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | C[C@]12CC[C@H](c3cccnc3)C[C@@]1(O)CC[C@@H]2C=NOCCN |
| InChI | InChI=1S/C18H27N3O2/c1-17-6-4-14(15-3-2-9-20-12-15)11-18(17,22)7-5-16(17)13-21-23-10-8-19/h2-3,9,12-14,16,22H,4-8,10-11,19H2,1H3/t14-,16+,17+,18-/m0/s1 |
| InChIKey | SWCRSUNIUJUGHI-HPBDAGMYSA-N |
| XLogP | 2.46 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|