C24H38N2O2 — CID 173250545
(1R,3aS,5S,7aR)-1-[3-[2-(dimethylamino)ethoxyamino]-2-methylprop-1-enyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 173250545) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1R,3aS,5S,7aR)-1-[3-[2-(dimethylamino)ethoxyamino]-2-methylprop-1-enyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1R,3aS,5S,7aR)-1-[3-[2-(dimethylamino)ethoxyamino]-2-methylprop-1-enyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 173250545 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (1R,3aS,5S,7aR)-1-[3-[2-(dimethylamino)ethoxyamino]-2-methylprop-1-enyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | CC(=C[C@H]1CC[C@]2(O)C[C@@H](c3ccccc3)CC[C@]12C)CNOCCN(C)C |
| InChI | InChI=1S/C24H38N2O2/c1-19(18-25-28-15-14-26(3)4)16-22-11-13-24(27)17-21(10-12-23(22,24)2)20-8-6-5-7-9-20/h5-9,16,21-22,25,27H,10-15,17-18H2,1-4H3/t21-,22+,23+,24-/m0/s1 |
| InChIKey | XECSVDOGYOJKJS-KEZOAJOQSA-N |
| XLogP | 4.13 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|