C30H60O8Si2 — CID 173251093
(4R,6S,7R,8S,10R)-7-tert-butyl-4-dimethylsilyloxy-6,8-dimethoxy-4,10-dimethyl-2,3-dioxo-11-tri(propan-2-yl)silyloxyundecanoic acid (PubChem CID 173251093) has the molecular formula C30H60O8Si2 and a molecular weight of 604.97 g/mol. Its IUPAC name is (4R,6S,7R,8S,10R)-7-tert-butyl-4-dimethylsilyloxy-6,8-dimethoxy-4,10-dimethyl-2,3-dioxo-11-tri(propan-2-yl)silyloxyundecanoic acid.
| Compound Name | (4R,6S,7R,8S,10R)-7-tert-butyl-4-dimethylsilyloxy-6,8-dimethoxy-4,10-dimethyl-2,3-dioxo-11-tri(propan-2-yl)silyloxyundecanoic acid |
|---|---|
| PubChem CID | 173251093 |
| Molecular Formula | C30H60O8Si2 |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | (4R,6S,7R,8S,10R)-7-tert-butyl-4-dimethylsilyloxy-6,8-dimethoxy-4,10-dimethyl-2,3-dioxo-11-tri(propan-2-yl)silyloxyundecanoic acid |
| SMILES | CO[C@@H](C[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]([C@H](C[C@@](C)(O[SiH](C)C)C(=O)C(=O)C(=O)O)OC)C(C)(C)C |
| InChI | InChI=1S/C30H60O8Si2/c1-19(2)40(20(3)4,21(5)6)37-18-22(7)16-23(35-12)25(29(8,9)10)24(36-13)17-30(11,38-39(14)15)27(32)26(31)28(33)34/h19-25,39H,16-18H2,1-15H3,(H,33,34)/t22-,23+,24+,25-,30-/m1/s1 |
| InChIKey | LIDODZBIJDMQKP-PCAJUUEESA-N |
| XLogP | 6.27 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|