C20H23NO3 — CID 173251252
7-(cyclohexa-1,5-dien-1-ylmethoxy)-3-ethyl-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one (PubChem CID 173251252) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 7-(cyclohexa-1,5-dien-1-ylmethoxy)-3-ethyl-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one.
| Compound Name | 7-(cyclohexa-1,5-dien-1-ylmethoxy)-3-ethyl-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
|---|---|
| PubChem CID | 173251252 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 7-(cyclohexa-1,5-dien-1-ylmethoxy)-3-ethyl-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
| SMILES | CCC1OC(=O)N2c3ccc(OCC4=CCCC=C4)cc3CCC12 |
| InChI | InChI=1S/C20H23NO3/c1-2-19-18-10-8-15-12-16(23-13-14-6-4-3-5-7-14)9-11-17(15)21(18)20(22)24-19/h4,6-7,9,11-12,18-19H,2-3,5,8,10,13H2,1H3 |
| InChIKey | XEYNMVMFYZSHSJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |