About 3-(3,5-dimethyl-4-pyridinyl)butanamide
3-(3,5-dimethyl-4-pyridinyl)butanamide (PubChem CID 173252399) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-pyridinyl)butanamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-4-pyridinyl)butanamide |
| PubChem CID | 173252399 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-(3,5-dimethyl-4-pyridinyl)butanamide |
| SMILES | Cc1cncc(C)c1C(C)CC(N)=O |
| InChI | InChI=1S/C11H16N2O/c1-7(4-10(12)14)11-8(2)5-13-6-9(11)3/h5-7H,4H2,1-3H3,(H2,12,14) |
| InChIKey | WUPLJWKMPHHJQR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dimethyl-4-pyridinyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-4-pyridinyl)butanamide?
The IUPAC name of 3-(3,5-dimethyl-4-pyridinyl)butanamide (CID 173252399) is 3-(3,5-dimethyl-4-pyridinyl)butanamide.
What is the SMILES notation for 3-(3,5-dimethyl-4-pyridinyl)butanamide?
The canonical SMILES for 3-(3,5-dimethyl-4-pyridinyl)butanamide is Cc1cncc(C)c1C(C)CC(N)=O.
What is the InChIKey of 3-(3,5-dimethyl-4-pyridinyl)butanamide?
The InChIKey is WUPLJWKMPHHJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-7(4-10(12)14)11-8(2)5-13-6-9(11)3/h5-7H,4H2,1-3H3,(H2,12,14).
What are the key properties of 3-(3,5-dimethyl-4-pyridinyl)butanamide?
3-(3,5-dimethyl-4-pyridinyl)butanamide has a molecular weight of 192.26 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-4-pyridinyl)butanamide is sourced from PubChem (CID 173252399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).