About 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine
2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine (PubChem CID 173252775) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 173252775 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine |
| SMILES | CC1=C(N)CCC=C1OCCN1CCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-11-12(14)5-4-6-13(11)16-10-9-15-7-2-3-8-15/h6H,2-5,7-10,14H2,1H3 |
| InChIKey | QQODLIWNPHMQSS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine (CID 173252775) is 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine is CC1=C(N)CCC=C1OCCN1CCCC1.
What is the InChIKey of 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine?
The InChIKey is QQODLIWNPHMQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-11-12(14)5-4-6-13(11)16-10-9-15-7-2-3-8-15/h6H,2-5,7-10,14H2,1H3.
What are the key properties of 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine?
2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine has a molecular weight of 222.33 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 173252775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).