About 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium
2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium (PubChem CID 173252795) has the molecular formula C10H7ClN3+
and a molecular weight of 204.64 g/mol. Its IUPAC name is 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium.
Molecular Properties
| Compound Name | 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium |
| PubChem CID | 173252795 |
| Molecular Formula | C10H7ClN3+ |
| Molecular Weight | 204.64 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium |
| SMILES | Clc1c[nH+]c2ccc3nccc3c2[nH]1 |
| InChI | InChI=1S/C10H6ClN3/c11-9-5-13-8-2-1-7-6(3-4-12-7)10(8)14-9/h1-5,14H/p+1 |
| InChIKey | LKHSFKLMUNMAPL-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.64 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium?
The IUPAC name of 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium (CID 173252795) is 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium.
What is the SMILES notation for 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium?
The canonical SMILES for 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium is Clc1c[nH+]c2ccc3nccc3c2[nH]1.
What is the InChIKey of 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium?
The InChIKey is LKHSFKLMUNMAPL-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H6ClN3/c11-9-5-13-8-2-1-7-6(3-4-12-7)10(8)14-9/h1-5,14H/p+1.
What are the key properties of 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium?
2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium has a molecular weight of 204.64 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1H-pyrrolo[3,2-f]quinoxalin-4-ium is sourced from PubChem (CID 173252795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).