About 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid
2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid (PubChem CID 173252959) has the molecular formula C16H18FNO6
and a molecular weight of 339.32 g/mol. Its IUPAC name is 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid.
Molecular Properties
| Compound Name | 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid |
| PubChem CID | 173252959 |
| Molecular Formula | C16H18FNO6 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid |
| SMILES | COC(CNC(=CC=C(C(=O)O)C(=O)O)c1ccc(F)cc1)OC |
| InChI | InChI=1S/C16H18FNO6/c1-23-14(24-2)9-18-13(10-3-5-11(17)6-4-10)8-7-12(15(19)20)16(21)22/h3-8,14,18H,9H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | GPOFDEUCOYNIJH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid?
The IUPAC name of 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid (CID 173252959) is 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid.
What is the SMILES notation for 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid?
The canonical SMILES for 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid is COC(CNC(=CC=C(C(=O)O)C(=O)O)c1ccc(F)cc1)OC.
What is the InChIKey of 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid?
The InChIKey is GPOFDEUCOYNIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO6/c1-23-14(24-2)9-18-13(10-3-5-11(17)6-4-10)8-7-12(15(19)20)16(21)22/h3-8,14,18H,9H2,1-2H3,(H,19,20)(H,21,22).
What are the key properties of 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid?
2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid has a molecular weight of 339.32 g/mol, XLogP of 1.47, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2-dimethoxyethylamino)-3-(4-fluorophenyl)prop-2-enylidene]propanedioic acid is sourced from PubChem (CID 173252959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).