C29H35NO4 — CID 173253783
3,3-dimethyl-2-oxo-5-[2-[5-(4-phenylmethoxyphenyl)pent-4-enoyl]pyrrolidin-1-yl]pentanal (PubChem CID 173253783) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxo-5-[2-[5-(4-phenylmethoxyphenyl)pent-4-enoyl]pyrrolidin-1-yl]pentanal.
| Compound Name | 3,3-dimethyl-2-oxo-5-[2-[5-(4-phenylmethoxyphenyl)pent-4-enoyl]pyrrolidin-1-yl]pentanal |
|---|---|
| PubChem CID | 173253783 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 3,3-dimethyl-2-oxo-5-[2-[5-(4-phenylmethoxyphenyl)pent-4-enoyl]pyrrolidin-1-yl]pentanal |
| SMILES | CC(C)(CCN1CCCC1C(=O)CCC=Cc1ccc(OCc2ccccc2)cc1)C(=O)C=O |
| InChI | InChI=1S/C29H35NO4/c1-29(2,28(33)21-31)18-20-30-19-8-12-26(30)27(32)13-7-6-9-23-14-16-25(17-15-23)34-22-24-10-4-3-5-11-24/h3-6,9-11,14-17,21,26H,7-8,12-13,18-20,22H2,1-2H3 |
| InChIKey | BCIVXUXJUPYCQP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|