C39H59N3O4 — CID 173253979
1-N,7-N-bis[2-(2,3-dimethoxyphenyl)ethyl]-1-N,4-N,7-N,3-tetramethyl-4-N-(2-phenylethyl)heptane-1,4,7-triamine (PubChem CID 173253979) has the molecular formula C39H59N3O4 and a molecular weight of 633.92 g/mol. Its IUPAC name is 1-N,7-N-bis[2-(2,3-dimethoxyphenyl)ethyl]-1-N,4-N,7-N,3-tetramethyl-4-N-(2-phenylethyl)heptane-1,4,7-triamine.
| Compound Name | 1-N,7-N-bis[2-(2,3-dimethoxyphenyl)ethyl]-1-N,4-N,7-N,3-tetramethyl-4-N-(2-phenylethyl)heptane-1,4,7-triamine |
|---|---|
| PubChem CID | 173253979 |
| Molecular Formula | C39H59N3O4 |
| Molecular Weight | 633.92 g/mol |
| Exact Mass | 633.45 |
| IUPAC Name | 1-N,7-N-bis[2-(2,3-dimethoxyphenyl)ethyl]-1-N,4-N,7-N,3-tetramethyl-4-N-(2-phenylethyl)heptane-1,4,7-triamine |
| SMILES | COc1cccc(CCN(C)CCCC(C(C)CCN(C)CCc2cccc(OC)c2OC)N(C)CCc2ccccc2)c1OC |
| InChI | InChI=1S/C39H59N3O4/c1-31(22-27-41(3)29-25-34-18-13-21-37(44-6)39(34)46-8)35(42(4)30-23-32-15-10-9-11-16-32)19-14-26-40(2)28-24-33-17-12-20-36(43-5)38(33)45-7/h9-13,15-18,20-21,31,35H,14,19,22-30H2,1-8H3 |
| InChIKey | YJYONPNEAYCOSX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.92 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |