About [1,3]thiazolo[5,4-f][1,3]benzothiazole
[1,3]thiazolo[5,4-f][1,3]benzothiazole (PubChem CID 17325439) has the molecular formula C8H4N2S2
and a molecular weight of 192.27 g/mol. Its IUPAC name is [1,3]thiazolo[5,4-f][1,3]benzothiazole.
Molecular Properties
| Compound Name | [1,3]thiazolo[5,4-f][1,3]benzothiazole |
| PubChem CID | 17325439 |
| Molecular Formula | C8H4N2S2 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | [1,3]thiazolo[5,4-f][1,3]benzothiazole |
| SMILES | c1nc2cc3scnc3cc2s1 |
| InChI | InChI=1S/C8H4N2S2/c1-5-8(12-3-9-5)2-6-7(1)11-4-10-6/h1-4H |
| InChIKey | JWLNXHODHNBWPR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]thiazolo[5,4-f][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]thiazolo[5,4-f][1,3]benzothiazole?
The IUPAC name of [1,3]thiazolo[5,4-f][1,3]benzothiazole (CID 17325439) is [1,3]thiazolo[5,4-f][1,3]benzothiazole.
What is the SMILES notation for [1,3]thiazolo[5,4-f][1,3]benzothiazole?
The canonical SMILES for [1,3]thiazolo[5,4-f][1,3]benzothiazole is c1nc2cc3scnc3cc2s1.
What is the InChIKey of [1,3]thiazolo[5,4-f][1,3]benzothiazole?
The InChIKey is JWLNXHODHNBWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2S2/c1-5-8(12-3-9-5)2-6-7(1)11-4-10-6/h1-4H.
What are the key properties of [1,3]thiazolo[5,4-f][1,3]benzothiazole?
[1,3]thiazolo[5,4-f][1,3]benzothiazole has a molecular weight of 192.27 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]thiazolo[5,4-f][1,3]benzothiazole is sourced from PubChem (CID 17325439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).