C8H16Cl6FNO3P2 — CID 173255105
dimethylaminooxy(fluoro)phosphinic acid;1,2,3,4,5,6-hexachlorocyclohexane;phosphane (PubChem CID 173255105) has the molecular formula C8H16Cl6FNO3P2 and a molecular weight of 467.88 g/mol. Its IUPAC name is dimethylaminooxy(fluoro)phosphinic acid;1,2,3,4,5,6-hexachlorocyclohexane;phosphane.
| Compound Name | dimethylaminooxy(fluoro)phosphinic acid;1,2,3,4,5,6-hexachlorocyclohexane;phosphane |
|---|---|
| PubChem CID | 173255105 |
| Molecular Formula | C8H16Cl6FNO3P2 |
| Molecular Weight | 467.88 g/mol |
| Exact Mass | 464.87 |
| IUPAC Name | dimethylaminooxy(fluoro)phosphinic acid;1,2,3,4,5,6-hexachlorocyclohexane;phosphane |
| SMILES | CN(C)OP(=O)(O)F.ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.P |
| InChI | InChI=1S/C6H6Cl6.C2H7FNO3P.H3P/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-4(2)7-8(3,5)6;/h1-6H;1-2H3,(H,5,6);1H3 |
| InChIKey | CLNVADPWZMVJPK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|