About ethoxyethane;silylsulfonylsilane
ethoxyethane;silylsulfonylsilane (PubChem CID 173255647) has the molecular formula C4H16O3SSi2
and a molecular weight of 200.41 g/mol. Its IUPAC name is ethoxyethane;silylsulfonylsilane.
Molecular Properties
| Compound Name | ethoxyethane;silylsulfonylsilane |
| PubChem CID | 173255647 |
| Molecular Formula | C4H16O3SSi2 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | ethoxyethane;silylsulfonylsilane |
| SMILES | CCOCC.O=S(=O)([SiH3])[SiH3] |
| InChI | InChI=1S/C4H10O.H6O2SSi2/c1-3-5-4-2;1-3(2,4)5/h3-4H2,1-2H3;4-5H3 |
| InChIKey | NVDAVWFJMOFSLY-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;silylsulfonylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;silylsulfonylsilane?
The IUPAC name of ethoxyethane;silylsulfonylsilane (CID 173255647) is ethoxyethane;silylsulfonylsilane.
What is the SMILES notation for ethoxyethane;silylsulfonylsilane?
The canonical SMILES for ethoxyethane;silylsulfonylsilane is CCOCC.O=S(=O)([SiH3])[SiH3].
What is the InChIKey of ethoxyethane;silylsulfonylsilane?
The InChIKey is NVDAVWFJMOFSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.H6O2SSi2/c1-3-5-4-2;1-3(2,4)5/h3-4H2,1-2H3;4-5H3.
What are the key properties of ethoxyethane;silylsulfonylsilane?
ethoxyethane;silylsulfonylsilane has a molecular weight of 200.41 g/mol, XLogP of -2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;silylsulfonylsilane is sourced from PubChem (CID 173255647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).