About 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide
5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide (PubChem CID 173256492) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide |
| PubChem CID | 173256492 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide |
| SMILES | CCCN(C)C(=O)c1cc(C(N)=O)nn1C |
| InChI | InChI=1S/C10H16N4O2/c1-4-5-13(2)10(16)8-6-7(9(11)15)12-14(8)3/h6H,4-5H2,1-3H3,(H2,11,15) |
| InChIKey | ZDJBNUZLHAOWLH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide?
The IUPAC name of 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide (CID 173256492) is 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide.
What is the SMILES notation for 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide?
The canonical SMILES for 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide is CCCN(C)C(=O)c1cc(C(N)=O)nn1C.
What is the InChIKey of 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide?
The InChIKey is ZDJBNUZLHAOWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-4-5-13(2)10(16)8-6-7(9(11)15)12-14(8)3/h6H,4-5H2,1-3H3,(H2,11,15).
What are the key properties of 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide?
5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide has a molecular weight of 224.26 g/mol, XLogP of 0.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N,1-dimethyl-5-N-propylpyrazole-3,5-dicarboxamide is sourced from PubChem (CID 173256492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).