About CID 173256646
CID 173256646 (PubChem CID 173256646) has the molecular formula C10H18O2Rb
and a molecular weight of 255.72 g/mol.
Molecular Properties
| Compound Name | CID 173256646 |
| PubChem CID | 173256646 |
| Molecular Formula | C10H18O2Rb |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | — |
| SMILES | CCC(C(=O)O)C1CCCCC1.[Rb] |
| InChI | InChI=1S/C10H18O2.Rb/c1-2-9(10(11)12)8-6-4-3-5-7-8;/h8-9H,2-7H2,1H3,(H,11,12); |
| InChIKey | JMELIJGSLLHQAZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 173256646 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173256646?
The IUPAC name of CID 173256646 (CID 173256646) is not available.
What is the SMILES notation for CID 173256646?
The canonical SMILES for CID 173256646 is CCC(C(=O)O)C1CCCCC1.[Rb].
What is the InChIKey of CID 173256646?
The InChIKey is JMELIJGSLLHQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.Rb/c1-2-9(10(11)12)8-6-4-3-5-7-8;/h8-9H,2-7H2,1H3,(H,11,12);.
What are the key properties of CID 173256646?
CID 173256646 has a molecular weight of 255.72 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173256646 is sourced from PubChem (CID 173256646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).