About 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol
11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol (PubChem CID 173257888) has the molecular formula C24H50N2O2
and a molecular weight of 398.68 g/mol. Its IUPAC name is 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol.
Molecular Properties
| Compound Name | 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol |
| PubChem CID | 173257888 |
| Molecular Formula | C24H50N2O2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol |
| SMILES | CCCCCCCCCC(O)C(N)(C=CCN)C(O)CCCCCCCCC |
| InChI | InChI=1S/C24H50N2O2/c1-3-5-7-9-11-13-15-18-22(27)24(26,20-17-21-25)23(28)19-16-14-12-10-8-6-4-2/h17,20,22-23,27-28H,3-16,18-19,21,25-26H2,1-2H3 |
| InChIKey | MATKWZWQCRJKPH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol?
The IUPAC name of 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol (CID 173257888) is 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol.
What is the SMILES notation for 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol?
The canonical SMILES for 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol is CCCCCCCCCC(O)C(N)(C=CCN)C(O)CCCCCCCCC.
What is the InChIKey of 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol?
The InChIKey is MATKWZWQCRJKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50N2O2/c1-3-5-7-9-11-13-15-18-22(27)24(26,20-17-21-25)23(28)19-16-14-12-10-8-6-4-2/h17,20,22-23,27-28H,3-16,18-19,21,25-26H2,1-2H3.
What are the key properties of 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol?
11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol has a molecular weight of 398.68 g/mol, XLogP of 5.20, 20 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-amino-11-(3-aminoprop-1-enyl)henicosane-10,12-diol is sourced from PubChem (CID 173257888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).