About 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride
3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride (PubChem CID 173258063) has the molecular formula C8H11Cl3V
and a molecular weight of 264.48 g/mol. Its IUPAC name is 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride.
Molecular Properties
| Compound Name | 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride |
| PubChem CID | 173258063 |
| Molecular Formula | C8H11Cl3V |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 262.94 |
| IUPAC Name | 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride |
| SMILES | CCC1=CCC(C)=[C-]1.[Cl-].[Cl-].[Cl-].[V+4] |
| InChI | InChI=1S/C8H11.3ClH.V/c1-3-8-5-4-7(2)6-8;;;;/h5H,3-4H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | FPMAYNJTTMZMBF-UHFFFAOYSA-K |
| XLogP | -6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride?
The IUPAC name of 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride (CID 173258063) is 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride.
What is the SMILES notation for 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride?
The canonical SMILES for 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride is CCC1=CCC(C)=[C-]1.[Cl-].[Cl-].[Cl-].[V+4].
What is the InChIKey of 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride?
The InChIKey is FPMAYNJTTMZMBF-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H11.3ClH.V/c1-3-8-5-4-7(2)6-8;;;;/h5H,3-4H2,1-2H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride?
3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride has a molecular weight of 264.48 g/mol, XLogP of -6.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methylcyclopenta-1,3-diene;vanadium(4+);trichloride is sourced from PubChem (CID 173258063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).