C34H35FN6O4 — CID 173258090
1-[(3R)-1-[2-(3-azabicyclo[3.2.2]nonan-3-yl)-2-oxoethyl]-5-(2-fluorophenyl)-9-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(hydroxyiminomethyl)phenyl]urea (PubChem CID 173258090) has the molecular formula C34H35FN6O4 and a molecular weight of 610.69 g/mol. Its IUPAC name is 1-[(3R)-1-[2-(3-azabicyclo[3.2.2]nonan-3-yl)-2-oxoethyl]-5-(2-fluorophenyl)-9-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(hydroxyiminomethyl)phenyl]urea.
| Compound Name | 1-[(3R)-1-[2-(3-azabicyclo[3.2.2]nonan-3-yl)-2-oxoethyl]-5-(2-fluorophenyl)-9-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(hydroxyiminomethyl)phenyl]urea |
|---|---|
| PubChem CID | 173258090 |
| Molecular Formula | C34H35FN6O4 |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | 1-[(3R)-1-[2-(3-azabicyclo[3.2.2]nonan-3-yl)-2-oxoethyl]-5-(2-fluorophenyl)-9-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(hydroxyiminomethyl)phenyl]urea |
| SMILES | Cc1cccc2c1N(CC(=O)N1CC3CCC(CC3)C1)C(=O)[C@H](NC(=O)Nc1cccc(C=NO)c1)N=C2c1ccccc1F |
| InChI | InChI=1S/C34H35FN6O4/c1-21-6-4-10-27-30(26-9-2-3-11-28(26)35)38-32(39-34(44)37-25-8-5-7-24(16-25)17-36-45)33(43)41(31(21)27)20-29(42)40-18-22-12-13-23(19-40)15-14-22/h2-11,16-17,22-23,32,45H,12-15,18-20H2,1H3,(H2,37,39,44)/t22?,23?,32-/m0/s1 |
| InChIKey | GGCINJJFGZTLTR-KHZVSIKASA-N |
| XLogP | 4.92 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|